About N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide
N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide (PubChem CID 139093656) has the molecular formula C18H30N4
and a molecular weight of 302.47 g/mol. Its IUPAC name is N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide.
Molecular Properties
| Compound Name | N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide |
| PubChem CID | 139093656 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide |
| SMILES | Cc1ncn(/C(=N\C2CCCCC2)NC2CCCCC2)c1C |
| InChI | InChI=1S/C18H30N4/c1-14-15(2)22(13-19-14)18(20-16-9-5-3-6-10-16)21-17-11-7-4-8-12-17/h13,16-17H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | DFHOWCIMRULMOV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide?
The IUPAC name of N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide (CID 139093656) is N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide.
What is the SMILES notation for N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide?
The canonical SMILES for N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide is Cc1ncn(/C(=N\C2CCCCC2)NC2CCCCC2)c1C.
What is the InChIKey of N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide?
The InChIKey is DFHOWCIMRULMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4/c1-14-15(2)22(13-19-14)18(20-16-9-5-3-6-10-16)21-17-11-7-4-8-12-17/h13,16-17H,3-12H2,1-2H3,(H,20,21).
What are the key properties of N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide?
N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide has a molecular weight of 302.47 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexyl-4,5-dimethylimidazole-1-carboximidamide is sourced from PubChem (CID 139093656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).