C30H29NO3 — CID 139093666
(15R,19R)-17-[2,6-di(propan-2-yl)phenyl]-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 139093666) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is (15R,19R)-17-[2,6-di(propan-2-yl)phenyl]-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[2,6-di(propan-2-yl)phenyl]-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 139093666 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (15R,19R)-17-[2,6-di(propan-2-yl)phenyl]-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)[C@@H]2C3c4ccccc4C(O)(c4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C30H29NO3/c1-16(2)18-12-9-13-19(17(3)4)27(18)31-28(32)25-24-20-10-5-7-14-22(20)30(34,26(25)29(31)33)23-15-8-6-11-21(23)24/h5-17,24-26,34H,1-4H3/t24?,25-,26+,30?/m1/s1 |
| InChIKey | FHMCEMLDSNOKPU-BBYYJEGRSA-N |
| XLogP | 5.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|