C42H38N2O4 — CID 139093756
methyl (10E)-5-methyl-6,7,14,15-tetradehydro-8,9,12,13-tetrahydrocyclododeca[b]indole-2-carboxylate (PubChem CID 139093756) has the molecular formula C42H38N2O4 and a molecular weight of 634.78 g/mol. Its IUPAC name is methyl (10E)-5-methyl-6,7,14,15-tetradehydro-8,9,12,13-tetrahydrocyclododeca[b]indole-2-carboxylate.
| Compound Name | methyl (10E)-5-methyl-6,7,14,15-tetradehydro-8,9,12,13-tetrahydrocyclododeca[b]indole-2-carboxylate |
|---|---|
| PubChem CID | 139093756 |
| Molecular Formula | C42H38N2O4 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | methyl (10E)-5-methyl-6,7,14,15-tetradehydro-8,9,12,13-tetrahydrocyclododeca[b]indole-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2C)C#CCC/C=C/CCC#C1.COC(=O)c1ccc2c(c1)c1c(n2C)C#CCC/C=C/CCC#C1 |
| InChI | InChI=1S/2C21H19NO2/c2*1-22-19-12-10-8-6-4-3-5-7-9-11-17(19)18-15-16(21(23)24-2)13-14-20(18)22/h2*3-4,13-15H,5-8H2,1-2H3/b2*4-3+ |
| InChIKey | COQNMSGLMMRQDQ-XOMXBQTJSA-N |
| XLogP | 7.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|