About (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone
(2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone (PubChem CID 139093803) has the molecular formula C23H16BrNO
and a molecular weight of 402.29 g/mol. Its IUPAC name is (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone.
Molecular Properties
| Compound Name | (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone |
| PubChem CID | 139093803 |
| Molecular Formula | C23H16BrNO |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)[C@H](c1ccccc1)c1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C23H16BrNO/c24-20-14-13-19(22-18(20)12-7-15-25-22)21(16-8-3-1-4-9-16)23(26)17-10-5-2-6-11-17/h1-15,21H/t21-/m1/s1 |
| InChIKey | BDVYDMLPZYPBKQ-OAQYLSRUSA-N |
| XLogP | 6.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone?
The IUPAC name of (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone (CID 139093803) is (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone.
What is the SMILES notation for (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone?
The canonical SMILES for (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone is O=C(c1ccccc1)[C@H](c1ccccc1)c1ccc(Br)c2cccnc12.
What is the InChIKey of (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone?
The InChIKey is BDVYDMLPZYPBKQ-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H16BrNO/c24-20-14-13-19(22-18(20)12-7-15-25-22)21(16-8-3-1-4-9-16)23(26)17-10-5-2-6-11-17/h1-15,21H/t21-/m1/s1.
What are the key properties of (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone?
(2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone has a molecular weight of 402.29 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(5-bromoquinolin-8-yl)-1,2-diphenylethanone is sourced from PubChem (CID 139093803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).