About (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one
(3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one (PubChem CID 139093857) has the molecular formula C33H27N3O
and a molecular weight of 481.60 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one.
Molecular Properties
| Compound Name | (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one |
| PubChem CID | 139093857 |
| Molecular Formula | C33H27N3O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one |
| SMILES | Cc1[nH]c2cc([C@]3(c4c[nH]c5ccccc45)C(=O)N(Cc4ccccc4)c4ccccc43)ccc2c1C |
| InChI | InChI=1S/C33H27N3O/c1-21-22(2)35-30-18-24(16-17-25(21)30)33(28-19-34-29-14-8-6-12-26(28)29)27-13-7-9-15-31(27)36(32(33)37)20-23-10-4-3-5-11-23/h3-19,34-35H,20H2,1-2H3/t33-/m0/s1 |
| InChIKey | QJLPTDOSFINLLU-XIFFEERXSA-N |
| XLogP | 7.15 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one?
The IUPAC name of (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one (CID 139093857) is (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one.
What is the SMILES notation for (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one?
The canonical SMILES for (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one is Cc1[nH]c2cc([C@]3(c4c[nH]c5ccccc45)C(=O)N(Cc4ccccc4)c4ccccc43)ccc2c1C.
What is the InChIKey of (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one?
The InChIKey is QJLPTDOSFINLLU-XIFFEERXSA-N. The full InChI is InChI=1S/C33H27N3O/c1-21-22(2)35-30-18-24(16-17-25(21)30)33(28-19-34-29-14-8-6-12-26(28)29)27-13-7-9-15-31(27)36(32(33)37)20-23-10-4-3-5-11-23/h3-19,34-35H,20H2,1-2H3/t33-/m0/s1.
What are the key properties of (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one?
(3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one has a molecular weight of 481.60 g/mol, XLogP of 7.15, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-benzyl-3-(2,3-dimethyl-1H-indol-6-yl)-3-(1H-indol-3-yl)indol-2-one is sourced from PubChem (CID 139093857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).