C46H42O6 — CID 139093931
(2S)-7-methoxy-1,1,2,3,4-pentakis(4-methoxyphenyl)-2H-naphthalene (PubChem CID 139093931) has the molecular formula C46H42O6 and a molecular weight of 690.84 g/mol. Its IUPAC name is (2S)-7-methoxy-1,1,2,3,4-pentakis(4-methoxyphenyl)-2H-naphthalene.
| Compound Name | (2S)-7-methoxy-1,1,2,3,4-pentakis(4-methoxyphenyl)-2H-naphthalene |
|---|---|
| PubChem CID | 139093931 |
| Molecular Formula | C46H42O6 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | (2S)-7-methoxy-1,1,2,3,4-pentakis(4-methoxyphenyl)-2H-naphthalene |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)[C@H](c3ccc(OC)cc3)C(c3ccc(OC)cc3)(c3ccc(OC)cc3)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C46H42O6/c1-47-35-17-7-30(8-18-35)43-41-28-27-40(52-6)29-42(41)46(33-13-23-38(50-4)24-14-33,34-15-25-39(51-5)26-16-34)45(32-11-21-37(49-3)22-12-32)44(43)31-9-19-36(48-2)20-10-31/h7-29,45H,1-6H3/t45-/m0/s1 |
| InChIKey | ODKYJXZPUOXQMQ-GWHBCOKCSA-N |
| XLogP | 9.83 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|