C31H29N3O2 — CID 139094277
1-(2,2-diphenylethenyl)-3-phenyl-3-(phenylcarbamoyl)-1-propan-2-ylurea (PubChem CID 139094277) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-(2,2-diphenylethenyl)-3-phenyl-3-(phenylcarbamoyl)-1-propan-2-ylurea.
| Compound Name | 1-(2,2-diphenylethenyl)-3-phenyl-3-(phenylcarbamoyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 139094277 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-(2,2-diphenylethenyl)-3-phenyl-3-(phenylcarbamoyl)-1-propan-2-ylurea |
| SMILES | CC(C)N(C=C(c1ccccc1)c1ccccc1)C(=O)N(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29N3O2/c1-24(2)33(23-29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)31(36)34(28-21-13-6-14-22-28)30(35)32-27-19-11-5-12-20-27/h3-24H,1-2H3,(H,32,35) |
| InChIKey | QAZZOBFGHCHOTR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'} |
|---|