About (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate
(3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate (PubChem CID 139094408) has the molecular formula C3H7N5O3
and a molecular weight of 161.12 g/mol. Its IUPAC name is (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate.
Molecular Properties
| Compound Name | (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate |
| PubChem CID | 139094408 |
| Molecular Formula | C3H7N5O3 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate |
| SMILES | Cc1n[nH]c([N-][N+](=O)[O-])[nH+]1.O |
| InChI | InChI=1S/C3H4N5O2.H2O/c1-2-4-3(6-5-2)7-8(9)10;/h1H3,(H-,4,5,6,7);1H2/q-1;/p+1 |
| InChIKey | ZBVIHAWMFAQSMT-UHFFFAOYSA-O |
| XLogP | -1.10 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate?
The IUPAC name of (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate (CID 139094408) is (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate.
What is the SMILES notation for (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate?
The canonical SMILES for (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate is Cc1n[nH]c([N-][N+](=O)[O-])[nH+]1.O.
What is the InChIKey of (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate?
The InChIKey is ZBVIHAWMFAQSMT-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H4N5O2.H2O/c1-2-4-3(6-5-2)7-8(9)10;/h1H3,(H-,4,5,6,7);1H2/q-1;/p+1.
What are the key properties of (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate?
(3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate has a molecular weight of 161.12 g/mol, XLogP of -1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1H-1,2,4-triazol-4-ium-5-yl)-nitroazanide;hydrate is sourced from PubChem (CID 139094408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).