C26H36N4+2 — CID 139094644
(1R,7R,13R,14R)-1,7-bis[(4-methylphenyl)methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane (PubChem CID 139094644) has the molecular formula C26H36N4+2 and a molecular weight of 404.60 g/mol. Its IUPAC name is (1R,7R,13R,14R)-1,7-bis[(4-methylphenyl)methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane.
| Compound Name | (1R,7R,13R,14R)-1,7-bis[(4-methylphenyl)methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
|---|---|
| PubChem CID | 139094644 |
| Molecular Formula | C26H36N4+2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (1R,7R,13R,14R)-1,7-bis[(4-methylphenyl)methyl]-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
| SMILES | Cc1ccc(C[N@+]23CCN4CC[N@+]5(Cc6ccc(C)cc6)CCN(CC2)[C@H]3[C@H]45)cc1 |
| InChI | InChI=1S/C26H36N4/c1-21-3-7-23(8-4-21)19-29-15-11-27-14-18-30(20-24-9-5-22(2)6-10-24)16-12-28(13-17-29)26(30)25(27)29/h3-10,25-26H,11-20H2,1-2H3/q+2/t25-,26-,29-,30-/m1/s1 |
| InChIKey | RSNYYCIHMUUTQN-OIWKEWRZSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|