About methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate
methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate (PubChem CID 139094743) has the molecular formula C10H10F5NO5S
and a molecular weight of 351.25 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate.
Molecular Properties
| Compound Name | methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate |
| PubChem CID | 139094743 |
| Molecular Formula | C10H10F5NO5S |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate |
| SMILES | COC(=O)[C@H]([C@H](O)c1ccc([N+](=O)[O-])cc1)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C10H10F5NO5S/c1-21-10(18)9(22(11,12,13,14)15)8(17)6-2-4-7(5-3-6)16(19)20/h2-5,8-9,17H,1H3/t8-,9+/m1/s1 |
| InChIKey | QVXAZXANKMZSLM-BDAKNGLRSA-N |
| XLogP | 3.47 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate?
The IUPAC name of methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate (CID 139094743) is methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate.
What is the SMILES notation for methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate?
The canonical SMILES for methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate is COC(=O)[C@H]([C@H](O)c1ccc([N+](=O)[O-])cc1)S(F)(F)(F)(F)F.
What is the InChIKey of methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate?
The InChIKey is QVXAZXANKMZSLM-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H10F5NO5S/c1-21-10(18)9(22(11,12,13,14)15)8(17)6-2-4-7(5-3-6)16(19)20/h2-5,8-9,17H,1H3/t8-,9+/m1/s1.
What are the key properties of methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate?
methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate has a molecular weight of 351.25 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-3-hydroxy-3-(4-nitrophenyl)-2-(pentafluoro-λ6-sulfanyl)propanoate is sourced from PubChem (CID 139094743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).