C11H17IO4 — CID 139094883
(3aS,4R,5R,7aS)-7-iodo-4,5-dimethoxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 139094883) has the molecular formula C11H17IO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is (3aS,4R,5R,7aS)-7-iodo-4,5-dimethoxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,4R,5R,7aS)-7-iodo-4,5-dimethoxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 139094883 |
| Molecular Formula | C11H17IO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (3aS,4R,5R,7aS)-7-iodo-4,5-dimethoxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C(I)=C[C@H]1OC |
| InChI | InChI=1S/C11H17IO4/c1-11(2)15-8-6(12)5-7(13-3)9(14-4)10(8)16-11/h5,7-10H,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | UOFADNSNYOZKSR-ZYUZMQFOSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|