C27H17BCl2F2N2 — CID 139094917
5,11-dichloro-2,2-difluoro-4,8,12-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139094917) has the molecular formula C27H17BCl2F2N2 and a molecular weight of 489.16 g/mol. Its IUPAC name is 5,11-dichloro-2,2-difluoro-4,8,12-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 5,11-dichloro-2,2-difluoro-4,8,12-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139094917 |
| Molecular Formula | C27H17BCl2F2N2 |
| Molecular Weight | 489.16 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 5,11-dichloro-2,2-difluoro-4,8,12-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(cc(Cl)c2-c2ccccc2)C(c2ccccc2)=C2C=C(Cl)C(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C27H17BCl2F2N2/c29-21-16-23-25(18-10-4-1-5-11-18)24-17-22(30)27(20-14-8-3-9-15-20)34(24)28(31,32)33(23)26(21)19-12-6-2-7-13-19/h1-17H |
| InChIKey | AAUFTGXSIWFFBH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.16 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|