About (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate
(2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 139095148) has the molecular formula C36H30N6O14S2
and a molecular weight of 834.80 g/mol. Its IUPAC name is (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate |
| PubChem CID | 139095148 |
| Molecular Formula | C36H30N6O14S2 |
| Molecular Weight | 834.80 g/mol |
| Exact Mass | 834.13 |
| IUPAC Name | (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Oc3c([N+](=O)[O-])cccc3[N+](=O)[O-])cccc12.CN(C)c1cccc2c(S(=O)(=O)Oc3c([N+](=O)[O-])cccc3[N+](=O)[O-])cccc12 |
| InChI | InChI=1S/2C18H15N3O7S/c2*1-19(2)14-8-3-7-13-12(14)6-4-11-17(13)29(26,27)28-18-15(20(22)23)9-5-10-16(18)21(24)25/h2*3-11H,1-2H3 |
| InChIKey | VSOPFHCRFUTAKA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 265.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 834.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate?
The IUPAC name of (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate (CID 139095148) is (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate.
What is the SMILES notation for (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate?
The canonical SMILES for (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate is CN(C)c1cccc2c(S(=O)(=O)Oc3c([N+](=O)[O-])cccc3[N+](=O)[O-])cccc12.CN(C)c1cccc2c(S(=O)(=O)Oc3c([N+](=O)[O-])cccc3[N+](=O)[O-])cccc12.
What is the InChIKey of (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate?
The InChIKey is VSOPFHCRFUTAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H15N3O7S/c2*1-19(2)14-8-3-7-13-12(14)6-4-11-17(13)29(26,27)28-18-15(20(22)23)9-5-10-16(18)21(24)25/h2*3-11H,1-2H3.
What are the key properties of (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate?
(2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate has a molecular weight of 834.80 g/mol, XLogP of 6.98, 12 rotatable bonds, 0 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dinitrophenyl) 5-(dimethylamino)naphthalene-1-sulfonate is sourced from PubChem (CID 139095148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).