C39H18F27N3O3 — CID 139095163
(3E)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)-1H-indol-2-one (PubChem CID 139095163) has the molecular formula C39H18F27N3O3 and a molecular weight of 1089.54 g/mol. Its IUPAC name is (3E)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)-1H-indol-2-one.
| Compound Name | (3E)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 139095163 |
| Molecular Formula | C39H18F27N3O3 |
| Molecular Weight | 1089.54 g/mol |
| Exact Mass | 1089.09 |
| IUPAC Name | (3E)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=C1Nc2ccccc2/C1=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=C1Nc2ccccc2/C1=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/3C13H6F9NO/c3*14-10(15,11(16,17)12(18,19)13(20,21)22)5-7-6-3-1-2-4-8(6)23-9(7)24/h3*1-5H,(H,23,24)/b3*7-5+ |
| InChIKey | ZRWRERXCDXFRPG-XURHLQOSSA-N |
| XLogP | 13.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.54 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|