About 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine
4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine (PubChem CID 139095340) has the molecular formula C66H45F9N6O3
and a molecular weight of 1141.11 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine |
| PubChem CID | 139095340 |
| Molecular Formula | C66H45F9N6O3 |
| Molecular Weight | 1141.11 g/mol |
| Exact Mass | 1140.34 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine |
| SMILES | COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1.COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1.COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1 |
| InChI | InChI=1S/3C22H15F3N2O/c3*1-28-17-10-6-14(7-11-17)18-13-20(27-19-3-2-12-26-21(18)19)15-4-8-16(9-5-15)22(23,24)25/h3*2-13H,1H3 |
| InChIKey | DWBNMZQXWUHHBO-UHFFFAOYSA-N |
| XLogP | 17.97 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1141.11 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine?
The IUPAC name of 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine (CID 139095340) is 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine.
What is the SMILES notation for 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine?
The canonical SMILES for 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine is COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1.COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1.COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3cccnc23)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine?
The InChIKey is DWBNMZQXWUHHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/3C22H15F3N2O/c3*1-28-17-10-6-14(7-11-17)18-13-20(27-19-3-2-12-26-21(18)19)15-4-8-16(9-5-15)22(23,24)25/h3*2-13H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine?
4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine has a molecular weight of 1141.11 g/mol, XLogP of 17.97, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,5-naphthyridine is sourced from PubChem (CID 139095340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).