C23H27NO3S — CID 139095529
(4S)-4-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decan-3-one (PubChem CID 139095529) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is (4S)-4-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decan-3-one.
| Compound Name | (4S)-4-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 139095529 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (4S)-4-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(CCCCC3)[C@H](c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-17-10-12-19(13-11-17)28(26,27)24-16-23(14-6-3-7-15-23)21(22(24)25)20-9-5-4-8-18(20)2/h4-5,8-13,21H,3,6-7,14-16H2,1-2H3/t21-/m1/s1 |
| InChIKey | XFXBNIXUTNBVBR-OAQYLSRUSA-N |
| XLogP | 4.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |