C13H20O3 — CID 139095690
methyl (1S,2S,3S,8aS)-2-hydroxy-3-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 139095690) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (1S,2S,3S,8aS)-2-hydroxy-3-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,2S,3S,8aS)-2-hydroxy-3-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139095690 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl (1S,2S,3S,8aS)-2-hydroxy-3-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](O)[C@@H](C)C=C2CCCC[C@H]21 |
| InChI | InChI=1S/C13H20O3/c1-8-7-9-5-3-4-6-10(9)11(12(8)14)13(15)16-2/h7-8,10-12,14H,3-6H2,1-2H3/t8-,10+,11-,12-/m0/s1 |
| InChIKey | SGEAPZXXEYPFLQ-IELRGYKMSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|