C18H12ClNO5 — CID 139095755
(3R,4R)-4-(2-chlorophenyl)-3-nitro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one (PubChem CID 139095755) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is (3R,4R)-4-(2-chlorophenyl)-3-nitro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | (3R,4R)-4-(2-chlorophenyl)-3-nitro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 139095755 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (3R,4R)-4-(2-chlorophenyl)-3-nitro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2c1[C@H](c1ccccc1Cl)[C@@H]([N+](=O)[O-])CO2 |
| InChI | InChI=1S/C18H12ClNO5/c19-12-7-3-1-5-10(12)15-13(20(22)23)9-24-17-11-6-2-4-8-14(11)25-18(21)16(15)17/h1-8,13,15H,9H2/t13-,15+/m0/s1 |
| InChIKey | NMJVWDKLMAOGJI-DZGCQCFKSA-N |
| XLogP | 3.62 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|