C28H28O5S — CID 139095784
(1S,9R)-5,6-dimethoxy-11-(4-methylphenyl)-12-(4-methylphenyl)sulfonyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5,11-tetraene (PubChem CID 139095784) has the molecular formula C28H28O5S and a molecular weight of 476.59 g/mol. Its IUPAC name is (1S,9R)-5,6-dimethoxy-11-(4-methylphenyl)-12-(4-methylphenyl)sulfonyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5,11-tetraene.
| Compound Name | (1S,9R)-5,6-dimethoxy-11-(4-methylphenyl)-12-(4-methylphenyl)sulfonyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5,11-tetraene |
|---|---|
| PubChem CID | 139095784 |
| Molecular Formula | C28H28O5S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (1S,9R)-5,6-dimethoxy-11-(4-methylphenyl)-12-(4-methylphenyl)sulfonyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5,11-tetraene |
| SMILES | COc1ccc2c(c1OC)C[C@H]1C[C@@H]2C(S(=O)(=O)c2ccc(C)cc2)=C(c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C28H28O5S/c1-17-5-9-19(10-6-17)26-28(34(29,30)21-11-7-18(2)8-12-21)24-16-20(33-26)15-23-22(24)13-14-25(31-3)27(23)32-4/h5-14,20,24H,15-16H2,1-4H3/t20-,24-/m0/s1 |
| InChIKey | DANFTSZAKRBAJF-RDPSFJRHSA-N |
| XLogP | 5.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |