C33H30O5S — CID 139095788
(1S,4aS,9aS)-6,7-dimethoxy-4-(4-methylphenyl)sulfonyl-1,3-diphenyl-1,4a,9,9a-tetrahydroindeno[2,1-c]pyran (PubChem CID 139095788) has the molecular formula C33H30O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is (1S,4aS,9aS)-6,7-dimethoxy-4-(4-methylphenyl)sulfonyl-1,3-diphenyl-1,4a,9,9a-tetrahydroindeno[2,1-c]pyran.
| Compound Name | (1S,4aS,9aS)-6,7-dimethoxy-4-(4-methylphenyl)sulfonyl-1,3-diphenyl-1,4a,9,9a-tetrahydroindeno[2,1-c]pyran |
|---|---|
| PubChem CID | 139095788 |
| Molecular Formula | C33H30O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (1S,4aS,9aS)-6,7-dimethoxy-4-(4-methylphenyl)sulfonyl-1,3-diphenyl-1,4a,9,9a-tetrahydroindeno[2,1-c]pyran |
| SMILES | COc1cc2c(cc1OC)[C@H]1C(S(=O)(=O)c3ccc(C)cc3)=C(c3ccccc3)O[C@H](c3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C33H30O5S/c1-21-14-16-25(17-15-21)39(34,35)33-30-26-20-29(37-3)28(36-2)19-24(26)18-27(30)31(22-10-6-4-7-11-22)38-32(33)23-12-8-5-9-13-23/h4-17,19-20,27,30-31H,18H2,1-3H3/t27-,30+,31+/m0/s1 |
| InChIKey | KYKQQYYAZNHIEA-LXLYTFERSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |