C46H56N4O4 — CID 139095821
N-[(1R,2S,4R,6S)-6-(4-methoxyphenyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridine-2-carboxamide (PubChem CID 139095821) has the molecular formula C46H56N4O4 and a molecular weight of 728.98 g/mol. Its IUPAC name is N-[(1R,2S,4R,6S)-6-(4-methoxyphenyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,4R,6S)-6-(4-methoxyphenyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139095821 |
| Molecular Formula | C46H56N4O4 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.43 |
| IUPAC Name | N-[(1R,2S,4R,6S)-6-(4-methoxyphenyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridine-2-carboxamide |
| SMILES | COc1ccc([C@@H]2C[C@@H]3C[C@H](NC(=O)c4ccccn4)[C@@]2(C)C3(C)C)cc1.COc1ccc([C@@H]2C[C@@H]3C[C@H](NC(=O)c4ccccn4)[C@@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/2C23H28N2O2/c2*1-22(2)16-13-18(15-8-10-17(27-4)11-9-15)23(22,3)20(14-16)25-21(26)19-7-5-6-12-24-19/h2*5-12,16,18,20H,13-14H2,1-4H3,(H,25,26)/t2*16-,18+,20+,23+/m11/s1 |
| InChIKey | YUTHIQHTADVBAW-GIGCTYLMSA-N |
| XLogP | 8.86 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |