C44H50N2O8 — CID 139095878
5-O-ethyl 3-O-methyl (3S,4R)-1,6-dimethyl-4-naphthalen-1-yl-3,4-dihydro-2H-pyridine-3,5-dicarboxylate (PubChem CID 139095878) has the molecular formula C44H50N2O8 and a molecular weight of 734.89 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl (3S,4R)-1,6-dimethyl-4-naphthalen-1-yl-3,4-dihydro-2H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl (3S,4R)-1,6-dimethyl-4-naphthalen-1-yl-3,4-dihydro-2H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139095878 |
| Molecular Formula | C44H50N2O8 |
| Molecular Weight | 734.89 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | 5-O-ethyl 3-O-methyl (3S,4R)-1,6-dimethyl-4-naphthalen-1-yl-3,4-dihydro-2H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C)C[C@@H](C(=O)OC)[C@@H]1c1cccc2ccccc12.CCOC(=O)C1=C(C)N(C)C[C@@H](C(=O)OC)[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/2C22H25NO4/c2*1-5-27-22(25)19-14(2)23(3)13-18(21(24)26-4)20(19)17-12-8-10-15-9-6-7-11-16(15)17/h2*6-12,18,20H,5,13H2,1-4H3/t2*18-,20+/m11/s1 |
| InChIKey | NCSIKPJAVSXWCK-MKGXGHDISA-N |
| XLogP | 6.99 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.89 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|