C12H16O4 — CID 139095932
(1S,4R,6S,7S,8R,9R,12R)-9-methoxy-6-methyl-3,10-dioxatetracyclo[5.4.1.01,8.04,12]dodecan-11-one (PubChem CID 139095932) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1S,4R,6S,7S,8R,9R,12R)-9-methoxy-6-methyl-3,10-dioxatetracyclo[5.4.1.01,8.04,12]dodecan-11-one.
| Compound Name | (1S,4R,6S,7S,8R,9R,12R)-9-methoxy-6-methyl-3,10-dioxatetracyclo[5.4.1.01,8.04,12]dodecan-11-one |
|---|---|
| PubChem CID | 139095932 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1S,4R,6S,7S,8R,9R,12R)-9-methoxy-6-methyl-3,10-dioxatetracyclo[5.4.1.01,8.04,12]dodecan-11-one |
| SMILES | CO[C@@H]1OC(=O)[C@]23CO[C@@H]4C[C@H](C)[C@H]([C@@H]12)[C@@H]43 |
| InChI | InChI=1S/C12H16O4/c1-5-3-6-8-7(5)9-10(14-2)16-11(13)12(8,9)4-15-6/h5-10H,3-4H2,1-2H3/t5-,6+,7-,8+,9-,10+,12-/m0/s1 |
| InChIKey | IMIGAVGWIVPOQR-FIUHEZNFSA-N |
| XLogP | 0.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |