C20H21N3 — CID 139095953
N,N-dimethyl-4-[(1R)-1-phenyl-2-pyrimidin-4-ylethyl]aniline (PubChem CID 139095953) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1R)-1-phenyl-2-pyrimidin-4-ylethyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1R)-1-phenyl-2-pyrimidin-4-ylethyl]aniline |
|---|---|
| PubChem CID | 139095953 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N,N-dimethyl-4-[(1R)-1-phenyl-2-pyrimidin-4-ylethyl]aniline |
| SMILES | CN(C)c1ccc([C@H](Cc2ccncn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-23(2)19-10-8-17(9-11-19)20(16-6-4-3-5-7-16)14-18-12-13-21-15-22-18/h3-13,15,20H,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | GPYHDXRGWHIEKI-HXUWFJFHSA-N |
| XLogP | 3.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|