C40H36N4S4 — CID 139095955
4-[2,2-bis(4-methylsulfanylphenyl)ethenyl]pyrimidine (PubChem CID 139095955) has the molecular formula C40H36N4S4 and a molecular weight of 701.02 g/mol. Its IUPAC name is 4-[2,2-bis(4-methylsulfanylphenyl)ethenyl]pyrimidine.
| Compound Name | 4-[2,2-bis(4-methylsulfanylphenyl)ethenyl]pyrimidine |
|---|---|
| PubChem CID | 139095955 |
| Molecular Formula | C40H36N4S4 |
| Molecular Weight | 701.02 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 4-[2,2-bis(4-methylsulfanylphenyl)ethenyl]pyrimidine |
| SMILES | CSc1ccc(C(=Cc2ccncn2)c2ccc(SC)cc2)cc1.CSc1ccc(C(=Cc2ccncn2)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/2C20H18N2S2/c2*1-23-18-7-3-15(4-8-18)20(13-17-11-12-21-14-22-17)16-5-9-19(24-2)10-6-16/h2*3-14H,1-2H3 |
| InChIKey | LSIGPEBITDUCRV-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.02 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |