About N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate
N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate (PubChem CID 139097101) has the molecular formula C14H19F3N2O3S
and a molecular weight of 352.38 g/mol. Its IUPAC name is N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
| PubChem CID | 139097101 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
| SMILES | CC(C)(C)NC1=[NH+]CCc2ccccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H18N2.CHF3O3S/c1-13(2,3)15-12-11-7-5-4-6-10(11)8-9-14-12;2-1(3,4)8(5,6)7/h4-7H,8-9H2,1-3H3,(H,14,15);(H,5,6,7) |
| InChIKey | MEZOVBWEGLFXJO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The IUPAC name of N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate (CID 139097101) is N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate.
What is the SMILES notation for N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The canonical SMILES for N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate is CC(C)(C)NC1=[NH+]CCc2ccccc21.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The InChIKey is MEZOVBWEGLFXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2.CHF3O3S/c1-13(2,3)15-12-11-7-5-4-6-10(11)8-9-14-12;2-1(3,4)8(5,6)7/h4-7H,8-9H2,1-3H3,(H,14,15);(H,5,6,7).
What are the key properties of N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate has a molecular weight of 352.38 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,4-dihydroisoquinolin-2-ium-1-amine;trifluoromethanesulfonate is sourced from PubChem (CID 139097101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).