About 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate
3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate (PubChem CID 139097109) has the molecular formula C19H21F3N2O3S
and a molecular weight of 414.45 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
| PubChem CID | 139097109 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
| SMILES | Cc1ccc(NC2=[NH+]C(C)(C)Cc3ccccc32)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H20N2.CHF3O3S/c1-13-8-10-15(11-9-13)19-17-16-7-5-4-6-14(16)12-18(2,3)20-17;2-1(3,4)8(5,6)7/h4-11H,12H2,1-3H3,(H,19,20);(H,5,6,7) |
| InChIKey | BGMZPPRQKZHECP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The IUPAC name of 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate (CID 139097109) is 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate.
What is the SMILES notation for 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The canonical SMILES for 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate is Cc1ccc(NC2=[NH+]C(C)(C)Cc3ccccc32)cc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
The InChIKey is BGMZPPRQKZHECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2.CHF3O3S/c1-13-8-10-15(11-9-13)19-17-16-7-5-4-6-14(16)12-18(2,3)20-17;2-1(3,4)8(5,6)7/h4-11H,12H2,1-3H3,(H,19,20);(H,5,6,7).
What are the key properties of 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate?
3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate has a molecular weight of 414.45 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N-(4-methylphenyl)-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate is sourced from PubChem (CID 139097109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).