C25H15BF15N — CID 139097345
[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139097345) has the molecular formula C25H15BF15N and a molecular weight of 625.18 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139097345 |
| Molecular Formula | C25H15BF15N |
| Molecular Weight | 625.18 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | [(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[C@@H]1CCC[C@H](C)[NH+]1[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H15BF15N/c1-6-4-3-5-7(2)42(6)26(8-11(27)17(33)23(39)18(34)12(8)28,9-13(29)19(35)24(40)20(36)14(9)30)10-15(31)21(37)25(41)22(38)16(10)32/h6-7,42H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | NCBZUMXABZPPLT-KNVOCYPGSA-N |
| XLogP | 4.59 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|