C22H19ClN4O2S — CID 1390975
5-[4-(3-chloroanilino)phthalazin-1-yl]-N,2-dimethylbenzenesulfonamide (PubChem CID 1390975) has the molecular formula C22H19ClN4O2S and a molecular weight of 438.94 g/mol. Its IUPAC name is 5-[4-(3-chloroanilino)phthalazin-1-yl]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[4-(3-chloroanilino)phthalazin-1-yl]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1390975 |
| Molecular Formula | C22H19ClN4O2S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 5-[4-(3-chloroanilino)phthalazin-1-yl]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(-c2nnc(Nc3cccc(Cl)c3)c3ccccc23)ccc1C |
| InChI | InChI=1S/C22H19ClN4O2S/c1-14-10-11-15(12-20(14)30(28,29)24-2)21-18-8-3-4-9-19(18)22(27-26-21)25-17-7-5-6-16(23)13-17/h3-13,24H,1-2H3,(H,25,27) |
| InChIKey | GMHDUGIQHQUTBH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |