C28H40N4O — CID 139097649
4-[2,6-di(propan-2-yl)phenyl]-5-[2,6-di(propan-2-yl)phenyl]imino-2,2-dimethyl-4-aza-2-azonia-1-azanidacyclopentan-3-one (PubChem CID 139097649) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenyl]-5-[2,6-di(propan-2-yl)phenyl]imino-2,2-dimethyl-4-aza-2-azonia-1-azanidacyclopentan-3-one.
| Compound Name | 4-[2,6-di(propan-2-yl)phenyl]-5-[2,6-di(propan-2-yl)phenyl]imino-2,2-dimethyl-4-aza-2-azonia-1-azanidacyclopentan-3-one |
|---|---|
| PubChem CID | 139097649 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenyl]-5-[2,6-di(propan-2-yl)phenyl]imino-2,2-dimethyl-4-aza-2-azonia-1-azanidacyclopentan-3-one |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1\[N-][N+](C)(C)C(=O)N1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H40N4O/c1-17(2)21-13-11-14-22(18(3)4)25(21)29-27-30-32(9,10)28(33)31(27)26-23(19(5)6)15-12-16-24(26)20(7)8/h11-20H,1-10H3/b29-27+ |
| InChIKey | YIEJEFUUMCJPJN-ORIPQNMZSA-N |
| XLogP | 8.17 |
| TPSA | 46.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|