C90H80B2N2 — CID 139098248
[4-[8-(4-pyridin-2-ylphenyl)naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 139098248) has the molecular formula C90H80B2N2 and a molecular weight of 1211.27 g/mol. Its IUPAC name is [4-[8-(4-pyridin-2-ylphenyl)naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[8-(4-pyridin-2-ylphenyl)naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 139098248 |
| Molecular Formula | C90H80B2N2 |
| Molecular Weight | 1211.27 g/mol |
| Exact Mass | 1210.65 |
| IUPAC Name | [4-[8-(4-pyridin-2-ylphenyl)naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3cccc4cccc(-c5ccc(-c6ccccn6)cc5)c34)cc2)c2c(C)cc(C)cc2C)c(C)c1.Cc1cc(C)c(B(c2ccc(-c3cccc4cccc(-c5ccc(-c6ccccn6)cc5)c34)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/2C45H40BN/c2*1-29-25-31(3)44(32(4)26-29)46(45-33(5)27-30(2)28-34(45)6)39-22-20-36(21-23-39)41-14-10-12-38-11-9-13-40(43(38)41)35-16-18-37(19-17-35)42-15-7-8-24-47-42/h2*7-28H,1-6H3 |
| InChIKey | DSNWDFYBERFIIJ-UHFFFAOYSA-N |
| XLogP | 19.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1211.27 |
| LogP ≤ 5 | 19.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|