C34H10BF20OP — CID 139098294
(3Z,5R)-3-ethylidene-2,2,4,4-tetrakis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane (PubChem CID 139098294) has the molecular formula C34H10BF20OP and a molecular weight of 856.20 g/mol. Its IUPAC name is (3Z,5R)-3-ethylidene-2,2,4,4-tetrakis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane.
| Compound Name | (3Z,5R)-3-ethylidene-2,2,4,4-tetrakis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 139098294 |
| Molecular Formula | C34H10BF20OP |
| Molecular Weight | 856.20 g/mol |
| Exact Mass | 856.02 |
| IUPAC Name | (3Z,5R)-3-ethylidene-2,2,4,4-tetrakis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane |
| SMILES | C/C=C1/[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)O[C@@H](c2ccccc2)[P+]1(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H10BF20OP/c1-2-9-35(10-12(36)16(40)20(44)17(41)13(10)37,11-14(38)18(42)21(45)19(43)15(11)39)56-34(8-6-4-3-5-7-8)57(9,32-28(52)24(48)22(46)25(49)29(32)53)33-30(54)26(50)23(47)27(51)31(33)55/h2-7,34H,1H3/b9-2-/t34-/m1/s1 |
| InChIKey | RJEUPCPECUAQNW-AYKNZTMGSA-N |
| XLogP | 9.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.20 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|