About CID 139098971
CID 139098971 (PubChem CID 139098971) has the molecular formula C66H90S6Si2
and a molecular weight of 1132.02 g/mol.
Molecular Properties
| Compound Name | CID 139098971 |
| PubChem CID | 139098971 |
| Molecular Formula | C66H90S6Si2 |
| Molecular Weight | 1132.02 g/mol |
| Exact Mass | 1130.49 |
| IUPAC Name | — |
| SMILES | CC(C)(C)SCc1ccccc1[Si](c1ccccc1CSC(C)(C)C)c1ccccc1CSC(C)(C)C.CC(C)(C)SCc1ccccc1[Si](c1ccccc1CSC(C)(C)C)c1ccccc1CSC(C)(C)C |
| InChI | InChI=1S/2C33H45S3Si/c2*1-31(2,3)34-22-25-16-10-13-19-28(25)37(29-20-14-11-17-26(29)23-35-32(4,5)6)30-21-15-12-18-27(30)24-36-33(7,8)9/h2*10-21H,22-24H2,1-9H3 |
| InChIKey | IJEBHXLIAQMWID-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1132.02 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 139098971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139098971?
The IUPAC name of CID 139098971 (CID 139098971) is not available.
What is the SMILES notation for CID 139098971?
The canonical SMILES for CID 139098971 is CC(C)(C)SCc1ccccc1[Si](c1ccccc1CSC(C)(C)C)c1ccccc1CSC(C)(C)C.CC(C)(C)SCc1ccccc1[Si](c1ccccc1CSC(C)(C)C)c1ccccc1CSC(C)(C)C.
What is the InChIKey of CID 139098971?
The InChIKey is IJEBHXLIAQMWID-UHFFFAOYSA-N. The full InChI is InChI=1S/2C33H45S3Si/c2*1-31(2,3)34-22-25-16-10-13-19-28(25)37(29-20-14-11-17-26(29)23-35-32(4,5)6)30-21-15-12-18-27(30)24-36-33(7,8)9/h2*10-21H,22-24H2,1-9H3.
What are the key properties of CID 139098971?
CID 139098971 has a molecular weight of 1132.02 g/mol, XLogP of 16.60, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139098971 is sourced from PubChem (CID 139098971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).