C28H80Si12 — CID 139099652
trimethyl-[1-trimethylsilyl-3,3-bis[tris(trimethylsilyl)silylmethyl]-1,3-disiletan-1-yl]silane (PubChem CID 139099652) has the molecular formula C28H80Si12 and a molecular weight of 753.98 g/mol. Its IUPAC name is trimethyl-[1-trimethylsilyl-3,3-bis[tris(trimethylsilyl)silylmethyl]-1,3-disiletan-1-yl]silane.
| Compound Name | trimethyl-[1-trimethylsilyl-3,3-bis[tris(trimethylsilyl)silylmethyl]-1,3-disiletan-1-yl]silane |
|---|---|
| PubChem CID | 139099652 |
| Molecular Formula | C28H80Si12 |
| Molecular Weight | 753.98 g/mol |
| Exact Mass | 752.35 |
| IUPAC Name | trimethyl-[1-trimethylsilyl-3,3-bis[tris(trimethylsilyl)silylmethyl]-1,3-disiletan-1-yl]silane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)C[Si](C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)(C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C28H80Si12/c1-29(2,3)38(30(4,5)6)25-37(26-38,27-39(31(7,8)9,32(10,11)12)33(13,14)15)28-40(34(16,17)18,35(19,20)21)36(22,23)24/h25-28H2,1-24H3 |
| InChIKey | FPLSSJXHISDUDU-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.98 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|