About CID 139100541
CID 139100541 (PubChem CID 139100541) has the molecular formula C81H108B3N6
and a molecular weight of 1198.23 g/mol.
Molecular Properties
| Compound Name | CID 139100541 |
| PubChem CID | 139100541 |
| Molecular Formula | C81H108B3N6 |
| Molecular Weight | 1198.23 g/mol |
| Exact Mass | 1197.89 |
| IUPAC Name | — |
| SMILES | [B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C.[B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C.[B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C |
| InChI | InChI=1S/3C27H36BN2/c3*1-19-13-9-11-15-21(19)23(26(3,4)5)29-17-18-30(25(29)28)24(27(6,7)8)22-16-12-10-14-20(22)2/h3*9-18,23-24H,1-8H3/t3*23-,24-/m111/s1 |
| InChIKey | MXNCHGIRRNDYMF-KXWFNGTPSA-N |
| XLogP | 16.37 |
| TPSA | 26.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 90 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1198.23 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 139100541 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139100541?
The IUPAC name of CID 139100541 (CID 139100541) is not available.
What is the SMILES notation for CID 139100541?
The canonical SMILES for CID 139100541 is [B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C.[B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C.[B-]c1n([C@H](c2ccccc2C)C(C)(C)C)cc[n+]1[C@H](c1ccccc1C)C(C)(C)C.
What is the InChIKey of CID 139100541?
The InChIKey is MXNCHGIRRNDYMF-KXWFNGTPSA-N. The full InChI is InChI=1S/3C27H36BN2/c3*1-19-13-9-11-15-21(19)23(26(3,4)5)29-17-18-30(25(29)28)24(27(6,7)8)22-16-12-10-14-20(22)2/h3*9-18,23-24H,1-8H3/t3*23-,24-/m111/s1.
What are the key properties of CID 139100541?
CID 139100541 has a molecular weight of 1198.23 g/mol, XLogP of 16.37, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139100541 is sourced from PubChem (CID 139100541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).