C30H15BClF10N — CID 139100591
chloro-(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)-diphenylmethyl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139100591) has the molecular formula C30H15BClF10N and a molecular weight of 625.70 g/mol. Its IUPAC name is chloro-(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)-diphenylmethyl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)-diphenylmethyl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139100591 |
| Molecular Formula | C30H15BClF10N |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)-diphenylmethyl]-pyridin-1-ium-1-ylboranuide |
| SMILES | Fc1c(F)c(F)c([B@@-](Cl)([n+]2ccccc2)C(c2ccccc2)(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H15BClF10N/c32-31(43-14-8-3-9-15-43,19-22(35)26(39)29(42)27(40)23(19)36)30(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-20(33)24(37)28(41)25(38)21(18)34/h1-15H/t31-/m1/s1 |
| InChIKey | AYSFMTUNXZHSPI-WJOKGBTCSA-N |
| XLogP | 7.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|