C26H4BCuF21N7 — CID 139103355
acetonitrile;copper(1+);tris[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]boranuide (PubChem CID 139103355) has the molecular formula C26H4BCuF21N7 and a molecular weight of 887.68 g/mol. Its IUPAC name is acetonitrile;copper(1+);tris[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]boranuide.
| Compound Name | acetonitrile;copper(1+);tris[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139103355 |
| Molecular Formula | C26H4BCuF21N7 |
| Molecular Weight | 887.68 g/mol |
| Exact Mass | 886.96 |
| IUPAC Name | acetonitrile;copper(1+);tris[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]boranuide |
| SMILES | CC#N.Fc1c(F)c(F)c2c(c(C(F)(F)F)nn2[BH-](n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)c1F.[Cu+] |
| InChI | InChI=1S/C24HBF21N6.C2H3N.Cu/c26-4-1-16(13(35)10(32)7(4)29)50(47-19(1)22(38,39)40)25(51-17-2(20(48-51)23(41,42)43)5(27)8(30)11(33)14(17)36)52-18-3(21(49-52)24(44,45)46)6(28)9(31)12(34)15(18)37;1-2-3;/h25H;1H3;/q-1;;+1 |
| InChIKey | OKIQJWHIZKSGSP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 77.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.68 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|