C11H12F6 — CID 139104303
2,3-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene (PubChem CID 139104303) has the molecular formula C11H12F6 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2,3-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene.
| Compound Name | 2,3-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 139104303 |
| Molecular Formula | C11H12F6 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2,3-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)CCC1=CCC=C1CCC(F)(F)F |
| InChI | InChI=1S/C11H12F6/c12-10(13,14)6-4-8-2-1-3-9(8)5-7-11(15,16)17/h2-3H,1,4-7H2 |
| InChIKey | GFKFVRAVOXAMNX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |