C48H50N6O2 — CID 139105478
2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline (PubChem CID 139105478) has the molecular formula C48H50N6O2 and a molecular weight of 742.97 g/mol. Its IUPAC name is 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline.
| Compound Name | 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline |
|---|---|
| PubChem CID | 139105478 |
| Molecular Formula | C48H50N6O2 |
| Molecular Weight | 742.97 g/mol |
| Exact Mass | 742.40 |
| IUPAC Name | 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline |
| SMILES | CC(C)[C@H]1COC(c2ccccc2Nc2ccccc2-c2ccccc2N)=N1.CC(C)[C@H]1COC(c2ccccc2Nc2ccccc2-c2ccccc2N)=N1 |
| InChI | InChI=1S/2C24H25N3O/c2*1-16(2)23-15-28-24(27-23)19-11-5-8-14-22(19)26-21-13-7-4-10-18(21)17-9-3-6-12-20(17)25/h2*3-14,16,23,26H,15,25H2,1-2H3/t2*23-/m11/s1 |
| InChIKey | CIRKTVSBUQWTOE-RFAQQLIWSA-N |
| XLogP | 10.96 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.97 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|