C28H13BF15NO2 — CID 139106140
[benzyl(dimethyl)azaniumyl]carbonyloxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139106140) has the molecular formula C28H13BF15NO2 and a molecular weight of 691.20 g/mol. Its IUPAC name is [benzyl(dimethyl)azaniumyl]carbonyloxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [benzyl(dimethyl)azaniumyl]carbonyloxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139106140 |
| Molecular Formula | C28H13BF15NO2 |
| Molecular Weight | 691.20 g/mol |
| Exact Mass | 691.08 |
| IUPAC Name | [benzyl(dimethyl)azaniumyl]carbonyloxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[N+](C)(Cc1ccccc1)C(=O)O[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H13BF15NO2/c1-45(2,8-9-6-4-3-5-7-9)28(46)47-29(10-13(30)19(36)25(42)20(37)14(10)31,11-15(32)21(38)26(43)22(39)16(11)33)12-17(34)23(40)27(44)24(41)18(12)35/h3-7H,8H2,1-2H3 |
| InChIKey | RADQERUNWBWSDA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.20 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|