C23H7BF15- — CID 139106173
[(Z)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139106173) has the molecular formula C23H7BF15- and a molecular weight of 579.09 g/mol. Its IUPAC name is [(Z)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(Z)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139106173 |
| Molecular Formula | C23H7BF15- |
| Molecular Weight | 579.09 g/mol |
| Exact Mass | 579.04 |
| IUPAC Name | [(Z)-2-cyclopropyl-1-(2,3,4,5,6-pentafluorophenyl)ethenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([BH-](/C(=C/C2CC2)c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C23H7BF15/c25-9-6(10(26)16(32)21(37)15(9)31)5(3-4-1-2-4)24(7-11(27)17(33)22(38)18(34)12(7)28)8-13(29)19(35)23(39)20(36)14(8)30/h3-4,24H,1-2H2/q-1/b5-3+ |
| InChIKey | PPMOQFFJJLSTQV-HWKANZROSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.09 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|