C31H11BF15N — CID 139106248
[(Z)-benzylidene(phenyl)azaniumyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139106248) has the molecular formula C31H11BF15N and a molecular weight of 693.22 g/mol. Its IUPAC name is [(Z)-benzylidene(phenyl)azaniumyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(Z)-benzylidene(phenyl)azaniumyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139106248 |
| Molecular Formula | C31H11BF15N |
| Molecular Weight | 693.22 g/mol |
| Exact Mass | 693.07 |
| IUPAC Name | [(Z)-benzylidene(phenyl)azaniumyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)/[N+](=C/c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C31H11BF15N/c33-17-14(18(34)24(40)29(45)23(17)39)32(15-19(35)25(41)30(46)26(42)20(15)36,16-21(37)27(43)31(47)28(44)22(16)38)48(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b48-11+ |
| InChIKey | LNTJAYSXIILGOH-TYMOTJJMSA-N |
| XLogP | 7.20 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.22 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|