About 2,3-dicyclohexyl-1,1-dimethylguanidine
2,3-dicyclohexyl-1,1-dimethylguanidine (PubChem CID 139106940) has the molecular formula C30H58N6
and a molecular weight of 502.84 g/mol. Its IUPAC name is 2,3-dicyclohexyl-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2,3-dicyclohexyl-1,1-dimethylguanidine |
| PubChem CID | 139106940 |
| Molecular Formula | C30H58N6 |
| Molecular Weight | 502.84 g/mol |
| Exact Mass | 502.47 |
| IUPAC Name | 2,3-dicyclohexyl-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\C1CCCCC1)NC1CCCCC1.CN(C)/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/2C15H29N3/c2*1-18(2)15(16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h2*13-14H,3-12H2,1-2H3,(H,16,17) |
| InChIKey | XKJBTCGUBJEATL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.84 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dicyclohexyl-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dicyclohexyl-1,1-dimethylguanidine?
The IUPAC name of 2,3-dicyclohexyl-1,1-dimethylguanidine (CID 139106940) is 2,3-dicyclohexyl-1,1-dimethylguanidine.
What is the SMILES notation for 2,3-dicyclohexyl-1,1-dimethylguanidine?
The canonical SMILES for 2,3-dicyclohexyl-1,1-dimethylguanidine is CN(C)/C(=N\C1CCCCC1)NC1CCCCC1.CN(C)/C(=N\C1CCCCC1)NC1CCCCC1.
What is the InChIKey of 2,3-dicyclohexyl-1,1-dimethylguanidine?
The InChIKey is XKJBTCGUBJEATL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H29N3/c2*1-18(2)15(16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h2*13-14H,3-12H2,1-2H3,(H,16,17).
What are the key properties of 2,3-dicyclohexyl-1,1-dimethylguanidine?
2,3-dicyclohexyl-1,1-dimethylguanidine has a molecular weight of 502.84 g/mol, XLogP of 6.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dicyclohexyl-1,1-dimethylguanidine is sourced from PubChem (CID 139106940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).