C33H31BF15P — CID 139107507
[2-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-1-enyl]-fluoro-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-tri(propan-2-yl)phosphaniumylphenyl]boranuide (PubChem CID 139107507) has the molecular formula C33H31BF15P and a molecular weight of 754.37 g/mol. Its IUPAC name is [2-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-1-enyl]-fluoro-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-tri(propan-2-yl)phosphaniumylphenyl]boranuide.
| Compound Name | [2-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-1-enyl]-fluoro-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-tri(propan-2-yl)phosphaniumylphenyl]boranuide |
|---|---|
| PubChem CID | 139107507 |
| Molecular Formula | C33H31BF15P |
| Molecular Weight | 754.37 g/mol |
| Exact Mass | 754.20 |
| IUPAC Name | [2-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-1-enyl]-fluoro-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-tri(propan-2-yl)phosphaniumylphenyl]boranuide |
| SMILES | CCC(CC)=C(c1c(F)c(F)c(F)c(F)c1F)[B@-](F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c([P+](C(C)C)(C(C)C)C(C)C)c(F)c1F |
| InChI | InChI=1S/C33H31BF15P/c1-9-14(10-2)16(15-19(35)25(41)29(45)26(42)20(15)36)34(49,17-21(37)27(43)30(46)28(44)22(17)38)18-23(39)31(47)33(32(48)24(18)40)50(11(3)4,12(5)6)13(7)8/h11-13H,9-10H2,1-8H3/t34-/m0/s1 |
| InChIKey | FMNNQASWYCUWNV-UMSFTDKQSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.37 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|