C62H98N2O4Si2 — CID 139108173
1,3,7,9-tetratert-butyl-5,11,11-trimethylbenzo[d][1,3,6,2]benzodioxazasilocine (PubChem CID 139108173) has the molecular formula C62H98N2O4Si2 and a molecular weight of 991.65 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-5,11,11-trimethylbenzo[d][1,3,6,2]benzodioxazasilocine.
| Compound Name | 1,3,7,9-tetratert-butyl-5,11,11-trimethylbenzo[d][1,3,6,2]benzodioxazasilocine |
|---|---|
| PubChem CID | 139108173 |
| Molecular Formula | C62H98N2O4Si2 |
| Molecular Weight | 991.65 g/mol |
| Exact Mass | 990.71 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-5,11,11-trimethylbenzo[d][1,3,6,2]benzodioxazasilocine |
| SMILES | CN1c2cc(C(C)(C)C)cc(C(C)(C)C)c2O[Si](C)(C)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C.CN1c2cc(C(C)(C)C)cc(C(C)(C)C)c2O[Si](C)(C)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/2C31H49NO2Si/c2*1-28(2,3)20-16-22(30(7,8)9)26-24(18-20)32(13)25-19-21(29(4,5)6)17-23(31(10,11)12)27(25)34-35(14,15)33-26/h2*16-19H,1-15H3 |
| InChIKey | PPVXPNWRQJEVLP-UHFFFAOYSA-N |
| XLogP | 18.24 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.65 |
| LogP ≤ 5 | 18.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|