C25H17BF15N — CID 139108647
(2R,6S)-2,6-dimethylpiperidin-1-ium;tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139108647) has the molecular formula C25H17BF15N and a molecular weight of 627.20 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethylpiperidin-1-ium;tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (2R,6S)-2,6-dimethylpiperidin-1-ium;tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139108647 |
| Molecular Formula | C25H17BF15N |
| Molecular Weight | 627.20 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | (2R,6S)-2,6-dimethylpiperidin-1-ium;tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[C@@H]1CCC[C@H](C)[NH2+]1.Fc1c(F)c(F)c([BH-](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18HBF15.C7H15N/c20-4-1(5(21)11(27)16(32)10(4)26)19(2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25;1-6-4-3-5-7(2)8-6/h19H;6-8H,3-5H2,1-2H3/q-1;/p+1/t;6-,7+ |
| InChIKey | MFDZTHJNBTVLGU-DAULDNKOSA-O |
| XLogP | 4.53 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|