About cyclohex-2-en-1-yl hexanoate
cyclohex-2-en-1-yl hexanoate (PubChem CID 139108915) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is cyclohex-2-en-1-yl hexanoate.
Molecular Properties
| Compound Name | cyclohex-2-en-1-yl hexanoate |
| PubChem CID | 139108915 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | cyclohex-2-en-1-yl hexanoate |
| SMILES | CCCCCC(=O)OC1C=CCCC1 |
| InChI | InChI=1S/C12H20O2/c1-2-3-5-10-12(13)14-11-8-6-4-7-9-11/h6,8,11H,2-5,7,9-10H2,1H3 |
| InChIKey | JFUUONWYGOKZLU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-2-en-1-yl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-2-en-1-yl hexanoate?
The IUPAC name of cyclohex-2-en-1-yl hexanoate (CID 139108915) is cyclohex-2-en-1-yl hexanoate.
What is the SMILES notation for cyclohex-2-en-1-yl hexanoate?
The canonical SMILES for cyclohex-2-en-1-yl hexanoate is CCCCCC(=O)OC1C=CCCC1.
What is the InChIKey of cyclohex-2-en-1-yl hexanoate?
The InChIKey is JFUUONWYGOKZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-2-3-5-10-12(13)14-11-8-6-4-7-9-11/h6,8,11H,2-5,7,9-10H2,1H3.
What are the key properties of cyclohex-2-en-1-yl hexanoate?
cyclohex-2-en-1-yl hexanoate has a molecular weight of 196.29 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-2-en-1-yl hexanoate is sourced from PubChem (CID 139108915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).