C22H18BF10N — CID 139109541
bis(2,3,4,5,6-pentafluorophenyl)-[(1S)-2-piperidin-1-ium-1-ylidenecyclopentyl]boranuide (PubChem CID 139109541) has the molecular formula C22H18BF10N and a molecular weight of 497.19 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[(1S)-2-piperidin-1-ium-1-ylidenecyclopentyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[(1S)-2-piperidin-1-ium-1-ylidenecyclopentyl]boranuide |
|---|---|
| PubChem CID | 139109541 |
| Molecular Formula | C22H18BF10N |
| Molecular Weight | 497.19 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[(1S)-2-piperidin-1-ium-1-ylidenecyclopentyl]boranuide |
| SMILES | Fc1c(F)c(F)c([BH-](c2c(F)c(F)c(F)c(F)c2F)[C@H]2CCCC2=[N+]2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C22H18BF10N/c24-13-11(14(25)18(29)21(32)17(13)28)23(12-15(26)19(30)22(33)20(31)16(12)27)9-5-4-6-10(9)34-7-2-1-3-8-34/h9,23H,1-8H2/t9-/m0/s1 |
| InChIKey | SRYIAOVAMXILPJ-VIFPVBQESA-N |
| XLogP | 4.61 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.19 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|