C30H24BF10N — CID 139109542
bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethynyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclopentyl]boranuide (PubChem CID 139109542) has the molecular formula C30H24BF10N and a molecular weight of 599.32 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethynyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclopentyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethynyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclopentyl]boranuide |
|---|---|
| PubChem CID | 139109542 |
| Molecular Formula | C30H24BF10N |
| Molecular Weight | 599.32 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethynyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclopentyl]boranuide |
| SMILES | Fc1c(F)c(F)c([B-](C#Cc2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)[C@H]2CCC[C@@H]2[NH+]2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C30H23BF10N/c32-21-19(22(33)26(37)29(40)25(21)36)31(13-12-16-8-3-1-4-9-16,20-23(34)27(38)30(41)28(39)24(20)35)17-10-7-11-18(17)42-14-5-2-6-15-42/h1,3-4,8-9,17-18H,2,5-7,10-11,14-15H2/q-1/p+1/t17-,18-/m0/s1 |
| InChIKey | BNTPGOCYNGNLQA-ROUUACIJSA-O |
| XLogP | 5.22 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|