C27H27BF10N2 — CID 139109546
tert-butylazaniumylidynemethyl-bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ylcyclopentyl]boranuide (PubChem CID 139109546) has the molecular formula C27H27BF10N2 and a molecular weight of 580.32 g/mol. Its IUPAC name is tert-butylazaniumylidynemethyl-bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ylcyclopentyl]boranuide.
| Compound Name | tert-butylazaniumylidynemethyl-bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ylcyclopentyl]boranuide |
|---|---|
| PubChem CID | 139109546 |
| Molecular Formula | C27H27BF10N2 |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | tert-butylazaniumylidynemethyl-bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ylcyclopentyl]boranuide |
| SMILES | CC(C)(C)[N+]#C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)[C@H]1CCC[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C27H27BF10N2/c1-27(2,3)39-12-28(15-17(29)21(33)25(37)22(34)18(15)30,16-19(31)23(35)26(38)24(36)20(16)32)13-8-7-9-14(13)40-10-5-4-6-11-40/h13-14H,4-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | VGLXSRASJLKXEV-KBPBESRZSA-N |
| XLogP | 6.72 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|